cas: 1122090-09-8 — see every product listed under this CAS number, including other names
Isopropyl 6-chloro-5-methylnicotinate, 95+% (CAS 1122090-09-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A347088-25g |
| cas | 1122090-09-8 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 41200.18 Pln | |
| AmBeed | 10g | 20973.61 Pln | |
| AmBeed | 5g | 12341.35 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Propan-2-yl 6-chloro-5-methylpyridine-3-carboxylate (CAS 1122090-09-8) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: propan-2-yl 6-chloro-5-methylpyridine-3-carboxylate. InChIKey: RLSTWMKSXAQQGU-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | propan-2-yl 6-chloro-5-methylpyridine-3-carboxylate |
| InChIKey | RLSTWMKSXAQQGU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1Cl)C(=O)OC(C)C |
Computed by PubChem (NCBI)