cas: 19382-38-8 — see every product listed under this CAS number, including other names
Isoquinolin-1-ylmethanamine dihydrochloride 95% (CAS 19382-38-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A691879-100mg |
| cas | 19382-38-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 320.31 Pln | |
| Ambeed | 5g | 1126.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A691879 |
Isoquinolin-1-ylmethanamine;dihydrochloride (CAS 19382-38-8) is a chemical compound with the molecular formula C10H12Cl2N2 and a molecular weight of 231.12 g/mol. IUPAC name: isoquinolin-1-ylmethanamine;dihydrochloride. InChIKey: NSZXYJPWXMGVFU-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2 |
|---|---|
| Molecular weight | 231.12 g/mol |
| IUPAC name | isoquinolin-1-ylmethanamine;dihydrochloride |
| InChIKey | NSZXYJPWXMGVFU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CN=C2CN.Cl.Cl |
Computed by PubChem (NCBI)