cas: 19382-38-8 — see every product listed under this CAS number, including other names
Isoquinolin-1-ylmethanamine dihydrochloride, 97% (CAS 19382-38-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F362210-250MG |
| cas | 19382-38-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 2.5g | 768.50 Pln | |
| Fluorochem | 5g | 1122.54 Pln | |
| Fluorochem | 10g | 2184.67 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Isoquinolin-1-ylmethanamine;dihydrochloride (CAS 19382-38-8) is a chemical compound with the molecular formula C10H12Cl2N2 and a molecular weight of 231.12 g/mol. IUPAC name: isoquinolin-1-ylmethanamine;dihydrochloride. InChIKey: NSZXYJPWXMGVFU-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2 |
|---|---|
| Molecular weight | 231.12 g/mol |
| IUPAC name | isoquinolin-1-ylmethanamine;dihydrochloride |
| InChIKey | NSZXYJPWXMGVFU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CN=C2CN.Cl.Cl |
Computed by PubChem (NCBI)