Isoquinolin-5-ylboronic acid, 97%
cas: 371766-08-4 — see every product listed under this CAS number, including other names
Isoquinolin-5-ylboronic acid, 97% (CAS 371766-08-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch118AG1-250mg |
| cas | 371766-08-4 |
| size | 250mg |
| availability | 200g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 328.40 Pln | |
| Chemat | 10g | 568.40 Pln | |
| Chemat | 25g | 1226.00 Pln | |
| Chemat | 100g | 4197.20 Pln | |
| BLDpharm | 250mg | 158.86 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 447.64 Pln | |
| BLDpharm | 10g | 814.18 Pln | |
| BLDpharm | 25g | 1752.74 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Isoquinolin-5-ylboronic acid (CAS 371766-08-4) is a chemical compound with the molecular formula C9H8BNO2 and a molecular weight of 172.98 g/mol. IUPAC name: isoquinolin-5-ylboronic acid. InChIKey: XKEYHBLSCGBBGU-UHFFFAOYSA-N.
| Molecular formula | C9H8BNO2 |
|---|---|
| Molecular weight | 172.98 g/mol |
| IUPAC name | isoquinolin-5-ylboronic acid |
| InChIKey | XKEYHBLSCGBBGU-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=CN=CC2=CC=C1)(O)O |
Computed by PubChem (NCBI)
Synonyms:
Isoquinoline-5-boronic acid, isoquinolin-5-ylboronic acid, 5-Isoquinolineboronic acid, Boronic acid, 5-isoquinolinyl-, 5-Isoquinolinylboronic acid, (isoquinolin-5-yl)boronic acid, isoquinolin-5-yl-5-boronic acid, 5-isoquinolylboronic acid, isoquinolin-5-boronic acid, Isoquinoline-5-boric acid