cas: 899438-92-7 — see every product listed under this CAS number, including other names
Isoquinolin-6-ylboronic acid, 98%, 98% (CAS 899438-92-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GUNZ-100mg |
| cas | 899438-92-7 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 520.40 Pln | |
| Chemat | 5g | 2200.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Isoquinolin-6-ylboronic acid (CAS 899438-92-7) is a chemical compound with the molecular formula C9H8BNO2 and a molecular weight of 172.98 g/mol. IUPAC name: isoquinolin-6-ylboronic acid. InChIKey: OBUOMTRFSCUDKS-UHFFFAOYSA-N.
| Molecular formula | C9H8BNO2 |
|---|---|
| Molecular weight | 172.98 g/mol |
| IUPAC name | isoquinolin-6-ylboronic acid |
| InChIKey | OBUOMTRFSCUDKS-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C=NC=C2)(O)O |
Computed by PubChem (NCBI)