Isoquinolin-6-ylboronic acid, 97%
cas: 899438-92-7 — see every product listed under this CAS number, including other names
Isoquinolin-6-ylboronic acid, 97% (CAS 899438-92-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F091637-100MG |
| cas | 899438-92-7 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 232.23 Pln | |
| Fluorochem | 250mg | 346.77 Pln | |
| Fluorochem | 1g | 601.89 Pln | |
| Fluorochem | 5g | 2033.68 Pln | |
| Fluorochem | 10g | 4001.73 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Isoquinolin-6-ylboronic acid (CAS 899438-92-7) is a chemical compound with the molecular formula C9H8BNO2 and a molecular weight of 172.98 g/mol. IUPAC name: isoquinolin-6-ylboronic acid. InChIKey: OBUOMTRFSCUDKS-UHFFFAOYSA-N.
| Molecular formula | C9H8BNO2 |
|---|---|
| Molecular weight | 172.98 g/mol |
| IUPAC name | isoquinolin-6-ylboronic acid |
| InChIKey | OBUOMTRFSCUDKS-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C=NC=C2)(O)O |
Computed by PubChem (NCBI)