cas: 21902-37-4 — see every product listed under this CAS number, including other names
Isoquinoline, 1,3-dichloro-7-methyl-, 97%, 97% (CAS 21902-37-4) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BECL-5g |
| cas | 21902-37-4 |
| size | 5g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 1643.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1,3-dichloro-7-methylisoquinoline (CAS 21902-37-4) is a chemical compound with the molecular formula C10H7Cl2N and a molecular weight of 212.07 g/mol. IUPAC name: 1,3-dichloro-7-methylisoquinoline. InChIKey: BPEFMJHEHCHWPC-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 1,3-dichloro-7-methylisoquinoline |
| InChIKey | BPEFMJHEHCHWPC-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N=C(C=C2C=C1)Cl)Cl |
Computed by PubChem (NCBI)