cas: 486-73-7 — see every product listed under this CAS number, including other names
Isoquinoline-1-carboxylic acid, 98% (CAS 486-73-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F019060-5G |
| cas | 486-73-7 |
| size | 5g |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 117.68 Pln | |
| Fluorochem | 10g | 133.30 Pln | |
| Fluorochem | 25g | 242.64 Pln | |
| Fluorochem | 100g | 674.78 Pln | |
| Fluorochem | 500g | 3074.98 Pln | |
| Fluorochem | 1kg | 5855.25 Pln | |
| Ambeed | 1kg | 6400.12 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 292.50 Pln | |
| Ambeed | 100g | 882.12 Pln | |
| Ambeed | 500g | 3602.19 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
Isoquinoline-1-carboxylic acid (CAS 486-73-7) is a chemical compound with the molecular formula C10H7NO2 and a molecular weight of 173.17 g/mol. IUPAC name: isoquinoline-1-carboxylic acid. InChIKey: XAAKCCMYRKZRAK-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | isoquinoline-1-carboxylic acid |
| InChIKey | XAAKCCMYRKZRAK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CN=C2C(=O)O |
Computed by PubChem (NCBI)