CAS 132-53-6 appears in our catalog under these names: 2-Nitroso-1-naphthol, 98%, 2-Nitroso-1-naphthol, 98% GC,T, 2–Nitroso–1–naphthol, 2-Nitroso-1-naphthol, >98.0%(GC)(T). Offered by: Combi-blocks, AmBeed, GLPBio, TCI. Available pack sizes: 1g, 25g, 5g, 10g.
2-nitrosonaphthalen-1-ol (CAS 132-53-6) is a chemical compound with the molecular formula C10H7NO2 and a molecular weight of 173.17 g/mol. IUPAC name: 2-nitrosonaphthalen-1-ol. InChIKey: SYUYTOYKQOAVDW-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | 2-nitrosonaphthalen-1-ol |
| InChIKey | SYUYTOYKQOAVDW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2O)N=O |
Computed by PubChem (NCBI)