Isoquinoline-8-carboxylic acid, 95%
cas: 61563-43-7 — see every product listed under this CAS number, including other names
Isoquinoline-8-carboxylic acid, 95% (CAS 61563-43-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A128028-250mg |
| cas | 61563-43-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 720.81 Pln | |
| Ambeed | 25g | 3301.81 Pln | |
| Ambeed | 100g | 10421.81 Pln | |
| BLDpharm | 100mg | 142.20 Pln | |
| BLDpharm | 250mg | 164.41 Pln | |
| BLDpharm | 1g | 303.25 Pln | |
| BLDpharm | 5g | 769.75 Pln | |
| BLDpharm | 25g | 3557.66 Pln | |
| BLDpharm | 100g | 11232.74 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Isoquinoline-8-carboxylic acid (CAS 61563-43-7) is a chemical compound with the molecular formula C10H7NO2 and a molecular weight of 173.17 g/mol. IUPAC name: isoquinoline-8-carboxylic acid. InChIKey: VMNZQPRIUSJCOH-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | isoquinoline-8-carboxylic acid |
| InChIKey | VMNZQPRIUSJCOH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=NC=C2)C(=C1)C(=O)O |
Computed by PubChem (NCBI)