cas: 56611-94-0 — see every product listed under this CAS number, including other names
L-Alanyl-D-alanine hydrochloride, 97% (CAS 56611-94-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F786473-100MG |
| cas | 56611-94-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 164.54 Pln | |
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 500mg | 502.97 Pln | |
| Fluorochem | 1g | 883.04 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoic acid;hydrochloride (CAS 56611-94-0) is a chemical compound with the molecular formula C6H13ClN2O3 and a molecular weight of 196.63 g/mol. IUPAC name: (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoic acid;hydrochloride. InChIKey: YKZTXOMGFUVZSN-MMALYQPHSA-N.
| Molecular formula | C6H13ClN2O3 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoic acid;hydrochloride |
| InChIKey | YKZTXOMGFUVZSN-MMALYQPHSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](C)C(=O)O)N.Cl |
Computed by PubChem (NCBI)