CAS 74817-54-2 appears in our catalog under these names: D-Glutamine methyl ester hydrochloride, 97%, H-D-Gln-OMe·HCl 95%, (R)-Methyl 2,5-diamino-5-oxopentanoate hydrochloride, 95%, 95%, D-Glutamine methyl ester hydrochloride, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
Methyl (2R)-2,5-diamino-5-oxopentanoate;hydrochloride (CAS 74817-54-2) is a chemical compound with the molecular formula C6H13ClN2O3 and a molecular weight of 196.63 g/mol. IUPAC name: methyl (2R)-2,5-diamino-5-oxopentanoate;hydrochloride. InChIKey: HGYBXODOMJPMNO-PGMHMLKASA-N.
| Molecular formula | C6H13ClN2O3 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | methyl (2R)-2,5-diamino-5-oxopentanoate;hydrochloride |
| InChIKey | HGYBXODOMJPMNO-PGMHMLKASA-N |
| SMILES | COC(=O)[C@@H](CCC(=O)N)N.Cl |
Computed by PubChem (NCBI)