CAS 32668-14-7 appears in our catalog under these names: L-Glutamine methyl ester hydrochloride, 95%, L-Glutamine Methyl Ester di-Hydrochloride, >95% (HPLC), H–Gln–OMe · HCl, H-L-Gln-OMe*HCl, L-GLUTAMINE METHYL ESTER HYDROCHLORIDE, 97%, 97%. Offered by: Combi-blocks, TRC, GLPBio, Iris Biotech, Chemat. Available pack sizes: 5g, 1g, 25g, 250mg, 2,5g, 100mg, 100g.
Methyl (2S)-2,5-diamino-5-oxopentanoate;hydrochloride (CAS 32668-14-7) is a chemical compound with the molecular formula C6H13ClN2O3 and a molecular weight of 196.63 g/mol. IUPAC name: methyl (2S)-2,5-diamino-5-oxopentanoate;hydrochloride. InChIKey: HGYBXODOMJPMNO-WCCKRBBISA-N.
| Molecular formula | C6H13ClN2O3 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | methyl (2S)-2,5-diamino-5-oxopentanoate;hydrochloride |
| InChIKey | HGYBXODOMJPMNO-WCCKRBBISA-N |
| SMILES | COC(=O)[C@H](CCC(=O)N)N.Cl |
Computed by PubChem (NCBI)