Products 23404-09-3
CAS 23404-09-3 appears in our catalog under these names: H-Ala-Gly-OMe hydrochloride, 98%, H–ALA–GLY–OME HCL, H-ALA-GLY-OME HCL, 98%, 98%, Methyl L-alanylglycinate hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
Methyl 2-[[(2S)-2-aminopropanoyl]amino]acetate;hydrochloride (CAS 23404-09-3) is a chemical compound with the molecular formula C6H13ClN2O3 and a molecular weight of 196.63 g/mol. IUPAC name: methyl 2-[[(2S)-2-aminopropanoyl]amino]acetate;hydrochloride. InChIKey: YPQGKQWQCHPXLB-WCCKRBBISA-N.
| Molecular formula | C6H13ClN2O3 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | methyl 2-[[(2S)-2-aminopropanoyl]amino]acetate;hydrochloride |
| InChIKey | YPQGKQWQCHPXLB-WCCKRBBISA-N |
| SMILES | C[C@@H](C(=O)NCC(=O)OC)N.Cl |
Computed by PubChem (NCBI)