Products 56611-94-0
CAS 56611-94-0 appears in our catalog under these names: L-Alanyl-l-alanine hydrochloride, 95%, L-Alanyl-D-alanine hydrochloride, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg, 500mg.
(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoic acid;hydrochloride (CAS 56611-94-0) is a chemical compound with the molecular formula C6H13ClN2O3 and a molecular weight of 196.63 g/mol. IUPAC name: (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoic acid;hydrochloride. InChIKey: YKZTXOMGFUVZSN-MMALYQPHSA-N.
| Molecular formula | C6H13ClN2O3 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoic acid;hydrochloride |
| InChIKey | YKZTXOMGFUVZSN-MMALYQPHSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](C)C(=O)O)N.Cl |
Computed by PubChem (NCBI)