Products 1218910-62-3

CAS 1218910-62-3 appears in our catalog under these names: methyl 2-amino-4-carbamoylbutanoate hydrochloride, 95%, Methyl 2-ao-4-carbamoylbutanoate hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 2,5-diamino-5-oxopentanoate;hydrochloride (CAS 1218910-62-3) is a chemical compound with the molecular formula C6H13ClN2O3 and a molecular weight of 196.63 g/mol. IUPAC name: methyl 2,5-diamino-5-oxopentanoate;hydrochloride. InChIKey: HGYBXODOMJPMNO-UHFFFAOYSA-N.

Identity
Molecular formulaC6H13ClN2O3
Molecular weight196.63 g/mol
IUPAC namemethyl 2,5-diamino-5-oxopentanoate;hydrochloride
InChIKeyHGYBXODOMJPMNO-UHFFFAOYSA-N
SMILESCOC(=O)C(CCC(=O)N)N.Cl

Computed by PubChem (NCBI)