Products 336182-05-9
CAS 336182-05-9 appears in our catalog under these names: L-Beta-homoglutamine hydrochloride, 95%, H–?–HoGln–OH?HCl. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 5g.
(3S)-3,6-diamino-6-oxohexanoic acid;hydrochloride (CAS 336182-05-9) is a chemical compound with the molecular formula C6H13ClN2O3 and a molecular weight of 196.63 g/mol. IUPAC name: (3S)-3,6-diamino-6-oxohexanoic acid;hydrochloride. InChIKey: UCMJADDIUIIUTC-WCCKRBBISA-N.
| Molecular formula | C6H13ClN2O3 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | (3S)-3,6-diamino-6-oxohexanoic acid;hydrochloride |
| InChIKey | UCMJADDIUIIUTC-WCCKRBBISA-N |
| SMILES | C(CC(=O)N)[C@@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
L-beta-Homoglutamine hydrochloride, L-beta-homoglutamine-HCl, L-|A-Homoglutamine hydrochloride, L-Beta-homoglutamine, HCl, (S)-3-Aminoadipic acid 6-amide hydrochloride, L-beta-Homoglutamine HCl, (S)-3,6-Diamino-6-oxohexanoic acid hydrochloride, (3S)-3,6-diamino-6-oxohexanoic acid;hydrochloride, H-beta-HoGln-OH.HCl, H-L-beta-HomoGln-OH HCl