cas: 962-39-0 — see every product listed under this CAS number, including other names
L-Phenylalanine benzyl ester (CAS 962-39-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 10g, 15g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117SE5-1g |
| cas | 962-39-0 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 25g | 1240.40 Pln | |
| Chemat | 10g | 597.20 Pln | |
| Chemat | 15g | 846.80 Pln |
| delivery time | 3 weeks |
|---|
Benzyl (2S)-2-amino-3-phenylpropanoate (CAS 962-39-0) is a chemical compound with the molecular formula C16H17NO2 and a molecular weight of 255.31 g/mol. IUPAC name: benzyl (2S)-2-amino-3-phenylpropanoate. InChIKey: FPRSPUHXEPWUBZ-HNNXBMFYSA-N.
| Molecular formula | C16H17NO2 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | benzyl (2S)-2-amino-3-phenylpropanoate |
| InChIKey | FPRSPUHXEPWUBZ-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)