CAS 47004-38-6 is the registry number for Benzyl D-phenylalaninate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (2R)-2-amino-3-phenylpropanoate (CAS 47004-38-6) is a chemical compound with the molecular formula C16H17NO2 and a molecular weight of 255.31 g/mol. IUPAC name: benzyl (2R)-2-amino-3-phenylpropanoate. InChIKey: FPRSPUHXEPWUBZ-OAHLLOKOSA-N.
| Molecular formula | C16H17NO2 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | benzyl (2R)-2-amino-3-phenylpropanoate |
| InChIKey | FPRSPUHXEPWUBZ-OAHLLOKOSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](C(=O)OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)