cas: 7524-52-9 — see every product listed under this CAS number, including other names
L-Tryptophan Methyl Ester Hydrochloride, 99%, 99% (CAS 7524-52-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147M3-5g |
| cas | 7524-52-9 |
| size | 5g |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 126.80 Pln | |
| Chemat | 500g | 446.40 Pln | |
| Chemat | 1kg | 808.40 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride (CAS 7524-52-9) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride. InChIKey: XNFNGGQRDXFYMM-PPHPATTJSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride |
| InChIKey | XNFNGGQRDXFYMM-PPHPATTJSA-N |
| SMILES | COC(=O)[C@H](CC1=CNC2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)