cas: 7524-52-9 — see every product listed under this CAS number, including other names
H-Trp-OMe.HCl, 98% (CAS 7524-52-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1kg, 1g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | M02993-5G |
| cas | 7524-52-9 |
| size | 5g |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 25g | 107.27 Pln | |
| Fluorochem | 100g | 195.78 Pln | |
| Fluorochem | 500g | 633.13 Pln | |
| Fluorochem | 1kg | 919.49 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 25g | 225.75 Pln | |
| Ambeed | 100g | 253.56 Pln | |
| Ambeed | 500g | 687.44 Pln | |
| Ambeed | 1kg | 887.69 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride (CAS 7524-52-9) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride. InChIKey: XNFNGGQRDXFYMM-PPHPATTJSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride |
| InChIKey | XNFNGGQRDXFYMM-PPHPATTJSA-N |
| SMILES | COC(=O)[C@H](CC1=CNC2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)