cas: 7524-52-9 — see every product listed under this CAS number, including other names
L-Tryptophan methyl ester hydrochloride, 98% (CAS 7524-52-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 376650050 |
| cas | 7524-52-9 |
| size | 5g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 264.59 Pln | |
| Thermo Scientific (Acros) | 25g | 895.34 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
Methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride (CAS 7524-52-9) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride. InChIKey: XNFNGGQRDXFYMM-PPHPATTJSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride |
| InChIKey | XNFNGGQRDXFYMM-PPHPATTJSA-N |
| SMILES | COC(=O)[C@H](CC1=CNC2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)