Products 852453-71-5
CAS 852453-71-5 appears in our catalog under these names: LASSBio–1135, LASSBio-1135/ 98.43% (existing batch purity), LASSBio-1135, ≥97%, ≥97%, LASSBio-1135, 99.05%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 25 mg, 10 mg.
N-phenyl-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-amine (CAS 852453-71-5) is a chemical compound with the molecular formula C18H14N4 and a molecular weight of 286.3 g/mol. IUPAC name: N-phenyl-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-amine. InChIKey: ULQALHCOPZRDMC-UHFFFAOYSA-N.
| Molecular formula | C18H14N4 |
|---|---|
| Molecular weight | 286.3 g/mol |
| IUPAC name | N-phenyl-2-pyridin-2-ylimidazo[1,2-a]pyridin-3-amine |
| InChIKey | ULQALHCOPZRDMC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=C(N=C3N2C=CC=C3)C4=CC=CC=N4 |
Computed by PubChem (NCBI)