cas: 1632032-53-1 — see every product listed under this CAS number, including other names
LB-100 98% (CAS 1632032-53-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 5mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A524930-1mg |
| cas | 1632032-53-1 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 242.44 Pln | |
| Ambeed | 2mg | 286.94 Pln | |
| Ambeed | 5mg | 342.56 Pln | |
| Ambeed | 25mg | 520.56 Pln | |
| Ambeed | 50mg | 654.06 Pln | |
| Ambeed | 100mg | 1054.56 Pln | |
| Ambeed | 250mg | 1922.31 Pln | |
| Ambeed | 1g | 5076.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A524930 |
(1R,4S)-3-(4-methylpiperazine-1-carbonyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid (CAS 1632032-53-1) is a chemical compound with the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. IUPAC name: (1R,4S)-3-(4-methylpiperazine-1-carbonyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid. InChIKey: JUQMLSGOTNKJKI-IZUQBHJASA-N.
| Molecular formula | C13H20N2O4 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | (1R,4S)-3-(4-methylpiperazine-1-carbonyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
| InChIKey | JUQMLSGOTNKJKI-IZUQBHJASA-N |
| SMILES | CN1CCN(CC1)C(=O)C2[C@@H]3CC[C@H](C2C(=O)O)O3 |
Computed by PubChem (NCBI)