CAS 418800-15-4 appears in our catalog under these names: Lenaldekar/ 99.25% (existing batch purity), Lenaldekar. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
N-[(E)-1H-indol-3-ylmethylideneamino]quinolin-8-amine (CAS 418800-15-4) is a chemical compound with the molecular formula C18H14N4 and a molecular weight of 286.3 g/mol. IUPAC name: N-[(E)-1H-indol-3-ylmethylideneamino]quinolin-8-amine. InChIKey: QLMFOQYHZJSYJF-CIAFOILYSA-N.
| Molecular formula | C18H14N4 |
|---|---|
| Molecular weight | 286.3 g/mol |
| IUPAC name | N-[(E)-1H-indol-3-ylmethylideneamino]quinolin-8-amine |
| InChIKey | QLMFOQYHZJSYJF-CIAFOILYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)/C=N/NC3=CC=CC4=C3N=CC=C4 |
Computed by PubChem (NCBI)