Products 2733716-88-4
CAS 2733716-88-4 appears in our catalog under these names: MCPA D6 100 µg/mL in Acetone, D6-MCPA, D6-MCPA, Concentration: 100 µg/ml Solvent: Acetone. Offered by: Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 1ml, 1x5mg, 1x1ml.
2-[4-chloro-2,3,5-trideuterio-6-(trideuteriomethyl)phenoxy]acetic acid (CAS 2733716-88-4) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 206.65 g/mol. IUPAC name: 2-[4-chloro-2,3,5-trideuterio-6-(trideuteriomethyl)phenoxy]acetic acid. InChIKey: WHKUVVPPKQRRBV-RLTMCGQMSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 206.65 g/mol |
| IUPAC name | 2-[4-chloro-2,3,5-trideuterio-6-(trideuteriomethyl)phenoxy]acetic acid |
| InChIKey | WHKUVVPPKQRRBV-RLTMCGQMSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1OCC(=O)O)C([2H])([2H])[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)