cas: 353525-11-8 — see every product listed under this CAS number, including other names
METHYL 2-(4-AMINO-3-HYDROXYPHENYL)ACETATE, 97% (CAS 353525-11-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F501067-100MG |
| cas | 353525-11-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 195.78 Pln | |
| Fluorochem | 250mg | 284.29 Pln | |
| Fluorochem | 1g | 851.80 Pln | |
| Fluorochem | 5g | 4038.18 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-(4-amino-3-hydroxyphenyl)acetate (CAS 353525-11-8) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: methyl 2-(4-amino-3-hydroxyphenyl)acetate. InChIKey: LZGUTYHAHOXRTO-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | methyl 2-(4-amino-3-hydroxyphenyl)acetate |
| InChIKey | LZGUTYHAHOXRTO-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC(=C(C=C1)N)O |
Computed by PubChem (NCBI)