cas: 910123-09-0 — see every product listed under this CAS number, including other names
METHYL 3,5-DIFLUORO-2-NITROBENZOATE, 95% (CAS 910123-09-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F306953-1G |
| cas | 910123-09-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 414.46 Pln | |
| Fluorochem | 25g | 1664.02 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 3,5-difluoro-2-nitrobenzoate (CAS 910123-09-0) is a chemical compound with the molecular formula C8H5F2NO4 and a molecular weight of 217.13 g/mol. IUPAC name: methyl 3,5-difluoro-2-nitrobenzoate. InChIKey: RDNFXAWOOHTXBF-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO4 |
|---|---|
| Molecular weight | 217.13 g/mol |
| IUPAC name | methyl 3,5-difluoro-2-nitrobenzoate |
| InChIKey | RDNFXAWOOHTXBF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)