cas: 1206727-13-0 — see every product listed under this CAS number, including other names
METHYL 3-AMINO-3-(3-HYDROXYPHENYL)PROPANOATE HCL (CAS 1206727-13-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387495-100MG |
| cas | 1206727-13-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 888.25 Pln | |
| Fluorochem | 250mg | 1034.03 Pln | |
| Fluorochem | 1g | 2205.49 Pln | |
| Fluorochem | 5g | 5751.12 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 3-amino-3-(3-hydroxyphenyl)propanoate;hydrochloride (CAS 1206727-13-0) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: methyl 3-amino-3-(3-hydroxyphenyl)propanoate;hydrochloride. InChIKey: ISRJRRVWAPZDPY-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | methyl 3-amino-3-(3-hydroxyphenyl)propanoate;hydrochloride |
| InChIKey | ISRJRRVWAPZDPY-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C1=CC(=CC=C1)O)N.Cl |
Computed by PubChem (NCBI)