cas: 1194374-71-4 — see every product listed under this CAS number, including other names
METHYL 5-FLUORO-2-FORMYLBENZOATE, 97% (CAS 1194374-71-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F531345-5G |
| cas | 1194374-71-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 2517.88 Pln | |
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 1g | 581.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 5-fluoro-2-formylbenzoate (CAS 1194374-71-4) is a chemical compound with the molecular formula C9H7FO3 and a molecular weight of 182.15 g/mol. IUPAC name: methyl 5-fluoro-2-formylbenzoate. InChIKey: OZWXXLYOYCZGTE-UHFFFAOYSA-N.
| Molecular formula | C9H7FO3 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | methyl 5-fluoro-2-formylbenzoate |
| InChIKey | OZWXXLYOYCZGTE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)F)C=O |
Computed by PubChem (NCBI)