cas: 954-16-5 — see every product listed under this CAS number, including other names
Mesityl(phenyl)methanone 98% (CAS 954-16-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A202515-5g |
| cas | 954-16-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 100g | 248.00 Pln | |
| Ambeed | 500g | 587.31 Pln | |
| Ambeed | 1000g | 954.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A202515 |
Phenyl-(2,4,6-trimethylphenyl)methanone (CAS 954-16-5) is a chemical compound with the molecular formula C16H16O and a molecular weight of 224.30 g/mol. IUPAC name: phenyl-(2,4,6-trimethylphenyl)methanone. InChIKey: HPAFOABSQZMTHE-UHFFFAOYSA-N.
| Molecular formula | C16H16O |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | phenyl-(2,4,6-trimethylphenyl)methanone |
| InChIKey | HPAFOABSQZMTHE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(=O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)