cas: 954-16-5 — see every product listed under this CAS number, including other names
Mesityl(phenyl)methanone, 98%, 98% (CAS 954-16-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 75g, 200g, 300g, 1g, 5g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1171DT-10g |
| cas | 954-16-5 |
| size | 10g |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 88.40 Pln | |
| Chemat | 75g | 146.00 Pln | |
| Chemat | 200g | 237.20 Pln | |
| Chemat | 300g | 318.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 25g | 88.40 Pln | |
| Chemat | 50g | 117.20 Pln | |
| Chemat | 100g | 146.00 Pln | |
| Chemat | 500g | 393.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Phenyl-(2,4,6-trimethylphenyl)methanone (CAS 954-16-5) is a chemical compound with the molecular formula C16H16O and a molecular weight of 224.30 g/mol. IUPAC name: phenyl-(2,4,6-trimethylphenyl)methanone. InChIKey: HPAFOABSQZMTHE-UHFFFAOYSA-N.
| Molecular formula | C16H16O |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | phenyl-(2,4,6-trimethylphenyl)methanone |
| InChIKey | HPAFOABSQZMTHE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(=O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)