cas: 954-16-5 — see every product listed under this CAS number, including other names
Mesityl(phenyl)methanone, 98% (CAS 954-16-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F228744-1G |
| cas | 954-16-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 10g | 112.48 Pln | |
| Fluorochem | 100g | 206.20 Pln | |
| Fluorochem | 500g | 508.17 Pln | |
| Fluorochem | 1kg | 888.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Phenyl-(2,4,6-trimethylphenyl)methanone (CAS 954-16-5) is a chemical compound with the molecular formula C16H16O and a molecular weight of 224.30 g/mol. IUPAC name: phenyl-(2,4,6-trimethylphenyl)methanone. InChIKey: HPAFOABSQZMTHE-UHFFFAOYSA-N.
| Molecular formula | C16H16O |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | phenyl-(2,4,6-trimethylphenyl)methanone |
| InChIKey | HPAFOABSQZMTHE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(=O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)