Mesityl(phenyl)methanone, 98%
cas: 954-16-5 — see every product listed under this CAS number, including other names
Mesityl(phenyl)methanone, 98% (CAS 954-16-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100g, 500g, 1kg, 1g, 10g, 25g, 5kg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A202515-5g |
| cas | 954-16-5 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 125.62 Pln | |
| Ambeed | 100g | 248.00 Pln | |
| Ambeed | 500g | 592.88 Pln | |
| Ambeed | 1kg | 965.56 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 93.20 Pln | |
| Chemat | 100g | 146.00 Pln | |
| Chemat | 500g | 480.00 Pln | |
| Chemat | 1kg | 707.60 Pln | |
| Chemat | 5kg | 3590.40 Pln | |
| BLDpharm | 5g | 125.54 Pln | |
| BLDpharm | 25g | 136.64 Pln | |
| BLDpharm | 100g | 236.61 Pln | |
| BLDpharm | 500g | 580.93 Pln | |
| BLDpharm | 1kg | 947.47 Pln | |
| Fluorochem | 1g | 102.06 Pln | |
| Fluorochem | 100g | 216.61 Pln | |
| Fluorochem | 500g | 539.41 Pln | |
| Fluorochem | 1kg | 935.11 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Phenyl-(2,4,6-trimethylphenyl)methanone (CAS 954-16-5) is a chemical compound with the molecular formula C16H16O and a molecular weight of 224.30 g/mol. IUPAC name: phenyl-(2,4,6-trimethylphenyl)methanone. InChIKey: HPAFOABSQZMTHE-UHFFFAOYSA-N.
| Molecular formula | C16H16O |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | phenyl-(2,4,6-trimethylphenyl)methanone |
| InChIKey | HPAFOABSQZMTHE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(=O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)
Synonyms:
2,4,6-Trimethylbenzophenone, Methanone, phenyl(2,4,6-trimethylphenyl)-, Ketone, mesityl phenyl, Benzophenone, 2,4,6-trimethyl-, Mesitylene, 2-benzoyl-, 2,4,6-Trimetilbenzofenon, HPAFOABSQZMTHE-UHFFFAOYSA-N, Mesityl(phenyl)methanone, Mesityl phenyl ketone, phenyl-(2,4,6-trimethylphenyl)methanone