CAS 1821656-07-8 appears in our catalog under these names: Methyl (1R,3R)-3-aminocyclohexane-1-carboxylate hydrochloride, 97%, 97%, Methyl (1R,3R)-3-aminocyclohexane-1-carboxylate hydrochloride, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Trans-methyl (1R,3R)-3-aminocyclohexane-1-carboxylate;hydrochloride (CAS 1821656-07-8) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: trans-methyl (1R,3R)-3-aminocyclohexane-1-carboxylate;hydrochloride. InChIKey: OOFXENVWECZJBF-ZJLYAJKPSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | trans-methyl (1R,3R)-3-aminocyclohexane-1-carboxylate;hydrochloride |
| InChIKey | OOFXENVWECZJBF-ZJLYAJKPSA-N |
| SMILES | COC(=O)[C@@H]1CCC[C@H](C1)N.Cl |
Computed by PubChem (NCBI)