cas: 225517-81-7 — see every product listed under this CAS number, including other names
Methyl (S)-4-N-Cbz-piperazine-2-carboxylate 97% (CAS 225517-81-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A473813-100mg |
| cas | 225517-81-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 153.44 Pln | |
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 442.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A473813 |
1-O-benzyl 3-O-methyl (3S)-piperazine-1,3-dicarboxylate (CAS 225517-81-7) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: 1-O-benzyl 3-O-methyl (3S)-piperazine-1,3-dicarboxylate. InChIKey: FYKXWBBQYZXPFB-LBPRGKRZSA-N.
| Molecular formula | C14H18N2O4 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 1-O-benzyl 3-O-methyl (3S)-piperazine-1,3-dicarboxylate |
| InChIKey | FYKXWBBQYZXPFB-LBPRGKRZSA-N |
| SMILES | COC(=O)[C@@H]1CN(CCN1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)