cas: 943111-83-9 — see every product listed under this CAS number, including other names
Methyl 1-(4-fluorophenyl)cyclopropanecarboxylate 98% (CAS 943111-83-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A829947-250mg |
| cas | 943111-83-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 209.06 Pln | |
| Ambeed | 5g | 770.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A829947 |
Methyl 1-(4-fluorophenyl)cyclopropane-1-carboxylate (CAS 943111-83-9) is a chemical compound with the molecular formula C11H11FO2 and a molecular weight of 194.20 g/mol. IUPAC name: methyl 1-(4-fluorophenyl)cyclopropane-1-carboxylate. InChIKey: PYHCKEAPWABESH-UHFFFAOYSA-N.
| Molecular formula | C11H11FO2 |
|---|---|
| Molecular weight | 194.20 g/mol |
| IUPAC name | methyl 1-(4-fluorophenyl)cyclopropane-1-carboxylate |
| InChIKey | PYHCKEAPWABESH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CC1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)