CAS 773873-95-3 appears in our catalog under these names: Methyl 2,2-difluorobenzo[d][1,3]dioxole-5-carboxylate, 98%, 98%, Methyl 2,2-difluorobenzo[d][1,3]dioxole-5-carboxylate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
Methyl 2,2-difluoro-1,3-benzodioxole-5-carboxylate (CAS 773873-95-3) is a chemical compound with the molecular formula C9H6F2O4 and a molecular weight of 216.14 g/mol. IUPAC name: methyl 2,2-difluoro-1,3-benzodioxole-5-carboxylate. InChIKey: MYEOSTSAKCEVAS-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O4 |
|---|---|
| Molecular weight | 216.14 g/mol |
| IUPAC name | methyl 2,2-difluoro-1,3-benzodioxole-5-carboxylate |
| InChIKey | MYEOSTSAKCEVAS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)OC(O2)(F)F |
Computed by PubChem (NCBI)