CAS 1415124-74-1 appears in our catalog under these names: 2,6-difluoro-4-(methoxycarbonyl)benzoic acid, 98%, 2，6–difluoro–4–(methoxycarbonyl)benzoic acid. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 100mg.
2,6-difluoro-4-methoxycarbonylbenzoic acid (CAS 1415124-74-1) is a chemical compound with the molecular formula C9H6F2O4 and a molecular weight of 216.14 g/mol. IUPAC name: 2,6-difluoro-4-methoxycarbonylbenzoic acid. InChIKey: OGVYQAUACPVKJH-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O4 |
|---|---|
| Molecular weight | 216.14 g/mol |
| IUPAC name | 2,6-difluoro-4-methoxycarbonylbenzoic acid |
| InChIKey | OGVYQAUACPVKJH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)F)C(=O)O)F |
Computed by PubChem (NCBI)