CAS 1183701-25-8 is the registry number for 2-(2,6-Difluoro-4-methoxyphenyl)-2-oxoacetic Acid. Offered by: TRC. Available pack sizes: 100mg.
2-(2,6-difluoro-4-methoxyphenyl)-2-oxoacetic acid (CAS 1183701-25-8) is a chemical compound with the molecular formula C9H6F2O4 and a molecular weight of 216.14 g/mol. IUPAC name: 2-(2,6-difluoro-4-methoxyphenyl)-2-oxoacetic acid. InChIKey: KEHUPPXBYYVOAH-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O4 |
|---|---|
| Molecular weight | 216.14 g/mol |
| IUPAC name | 2-(2,6-difluoro-4-methoxyphenyl)-2-oxoacetic acid |
| InChIKey | KEHUPPXBYYVOAH-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)F)C(=O)C(=O)O)F |
Computed by PubChem (NCBI)