Products 2320541-48-6

CAS 2320541-48-6 is the registry number for 6,7-Difluoro-2,3-dihydrobenzo[b][1,4]dioxine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

6,7-difluoro-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid (CAS 2320541-48-6) is a chemical compound with the molecular formula C9H6F2O4 and a molecular weight of 216.14 g/mol. IUPAC name: 6,7-difluoro-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid. InChIKey: JHAQLJYVNNOTLY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6F2O4
Molecular weight216.14 g/mol
IUPAC name6,7-difluoro-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid
InChIKeyJHAQLJYVNNOTLY-UHFFFAOYSA-N
SMILESC1C(OC2=CC(=C(C=C2O1)F)F)C(=O)O

Computed by PubChem (NCBI)