Products 1565972-46-4
CAS 1565972-46-4 is the registry number for 4,5-Difluoro-2-(methoxycarbonyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-difluoro-2-methoxycarbonylbenzoic acid (CAS 1565972-46-4) is a chemical compound with the molecular formula C9H6F2O4 and a molecular weight of 216.14 g/mol. IUPAC name: 4,5-difluoro-2-methoxycarbonylbenzoic acid. InChIKey: JNZKGGBNJNYYDZ-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O4 |
|---|---|
| Molecular weight | 216.14 g/mol |
| IUPAC name | 4,5-difluoro-2-methoxycarbonylbenzoic acid |
| InChIKey | JNZKGGBNJNYYDZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1C(=O)O)F)F |
Computed by PubChem (NCBI)