Products 120985-75-3
CAS 120985-75-3 is the registry number for 4-(Difluoromethyl)isophthalic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(difluoromethyl)benzene-1,3-dicarboxylic acid (CAS 120985-75-3) is a chemical compound with the molecular formula C9H6F2O4 and a molecular weight of 216.14 g/mol. IUPAC name: 4-(difluoromethyl)benzene-1,3-dicarboxylic acid. InChIKey: YJSAVSFLOUPXPO-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O4 |
|---|---|
| Molecular weight | 216.14 g/mol |
| IUPAC name | 4-(difluoromethyl)benzene-1,3-dicarboxylic acid |
| InChIKey | YJSAVSFLOUPXPO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C(=O)O)C(F)F |
Computed by PubChem (NCBI)
Synonyms:
4-(Difluoromethyl)isophthalic acid