CAS 1250313-60-0 appears in our catalog under these names: 6-(Difluoromethoxy)-2H-1,3-benzodioxole-5-carbaldehyde, 95%, 6-(Difluoromethoxy)-1,3-dioxaindane-5-carbaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-(difluoromethoxy)-1,3-benzodioxole-5-carbaldehyde (CAS 1250313-60-0) is a chemical compound with the molecular formula C9H6F2O4 and a molecular weight of 216.14 g/mol. IUPAC name: 6-(difluoromethoxy)-1,3-benzodioxole-5-carbaldehyde. InChIKey: CAPIEPIEIICTKG-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O4 |
|---|---|
| Molecular weight | 216.14 g/mol |
| IUPAC name | 6-(difluoromethoxy)-1,3-benzodioxole-5-carbaldehyde |
| InChIKey | CAPIEPIEIICTKG-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)C=O)OC(F)F |
Computed by PubChem (NCBI)