CAS 54335-33-0 appears in our catalog under these names: Methyl 2,4-dibromobenzoate, 96%, Methyl 2,4–dibromobenzoate, Methyl 2,4-dibromobenzoate, Methyl 2,4-dibromobenzoate, 97%, 97%, Methyl 2,4-dibromobenzoate, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 10g, 250mg.
Methyl 2,4-dibromobenzoate (CAS 54335-33-0) is a chemical compound with the molecular formula C8H6Br2O2 and a molecular weight of 293.94 g/mol. IUPAC name: methyl 2,4-dibromobenzoate. InChIKey: SBKBVWPHNYFFCV-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O2 |
|---|---|
| Molecular weight | 293.94 g/mol |
| IUPAC name | methyl 2,4-dibromobenzoate |
| InChIKey | SBKBVWPHNYFFCV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Br)Br |
Computed by PubChem (NCBI)