CAS 99615-74-4 appears in our catalog under these names: 2,4-Dibromo-5-methoxybenzaldehyde, 95%, 2,4-Dibromo-5-methoxybenzaldehyde, 98%, 98%, 2,4-Dibromo-5-methoxybenzaldehyde, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
2,4-dibromo-5-methoxybenzaldehyde (CAS 99615-74-4) is a chemical compound with the molecular formula C8H6Br2O2 and a molecular weight of 293.94 g/mol. IUPAC name: 2,4-dibromo-5-methoxybenzaldehyde. InChIKey: YNFYLBAXTVUPKS-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O2 |
|---|---|
| Molecular weight | 293.94 g/mol |
| IUPAC name | 2,4-dibromo-5-methoxybenzaldehyde |
| InChIKey | YNFYLBAXTVUPKS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C=O)Br)Br |
Computed by PubChem (NCBI)