CAS 128733-74-4 appears in our catalog under these names: 2,6-Dibromo-4-methylbenzoic acid, 95%, 2,6-Dibromo-4-methylbenzoic acid, 97%, 2,6-Dibromo-4-methylbenzoic acid, ≥95%, 2,6-Dibromo-4-methylbenzoic acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
2,6-dibromo-4-methylbenzoic acid (CAS 128733-74-4) is a chemical compound with the molecular formula C8H6Br2O2 and a molecular weight of 293.94 g/mol. IUPAC name: 2,6-dibromo-4-methylbenzoic acid. InChIKey: HPEDXYSIHYYYBL-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O2 |
|---|---|
| Molecular weight | 293.94 g/mol |
| IUPAC name | 2,6-dibromo-4-methylbenzoic acid |
| InChIKey | HPEDXYSIHYYYBL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Br)C(=O)O)Br |
Computed by PubChem (NCBI)