CAS 2887-72-1 appears in our catalog under these names: 1-(3,5-Dibromo-4-hydroxyphenyl)ethanone, 98%, 3',5'-Dibromo-4'-hydroxyacetophenone, 95%, 3',5'–Dibromo–4'–hydroxyacetophenone, 3',5'-Dibromo-4'-hydroxyacetophenone, 3',5'-Dibromo-4'-hydroxyacetophenone, >97.0%(GC). Offered by: Ambeed, Combi-blocks, GLPBio, Biosynth, TCI. Available pack sizes: 1g, 5g, 25g, 50g, 100g.
1-(3,5-dibromo-4-hydroxyphenyl)ethanone (CAS 2887-72-1) is a chemical compound with the molecular formula C8H6Br2O2 and a molecular weight of 293.94 g/mol. IUPAC name: 1-(3,5-dibromo-4-hydroxyphenyl)ethanone. InChIKey: ZNWPTJSBHHIXLJ-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O2 |
|---|---|
| Molecular weight | 293.94 g/mol |
| IUPAC name | 1-(3,5-dibromo-4-hydroxyphenyl)ethanone |
| InChIKey | ZNWPTJSBHHIXLJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C(=C1)Br)O)Br |
Computed by PubChem (NCBI)