CAS 881667-36-3 appears in our catalog under these names: Methyl 2,3-dibromobenzoate, 95%, Methyl 2,3-dibromobenzoate, 95+%, Methyl 2,3-dibromobenzoate, ≥95%, ≥95%, 2,3-Dibromo-benzoic acid methyl ester, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Methyl 2,3-dibromobenzoate (CAS 881667-36-3) is a chemical compound with the molecular formula C8H6Br2O2 and a molecular weight of 293.94 g/mol. IUPAC name: methyl 2,3-dibromobenzoate. InChIKey: QFSBSFMUOQBIND-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O2 |
|---|---|
| Molecular weight | 293.94 g/mol |
| IUPAC name | methyl 2,3-dibromobenzoate |
| InChIKey | QFSBSFMUOQBIND-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)Br)Br |
Computed by PubChem (NCBI)