CAS 100958-94-9 appears in our catalog under these names: 2-Methyl-3,5-dibromobenzoic acid, 95%, Canagliflozin Impurity 47, 3,5–Dibromo–2–methylbenzoic acid, 3,5-Dibromo-2-methylbenzoic acid, 97%, 97%, 3,5-Dibromo-2-methylbenzoic acid, 97%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, on request, 250mg, 100mg.
3,5-dibromo-2-methylbenzoic acid (CAS 100958-94-9) is a chemical compound with the molecular formula C8H6Br2O2 and a molecular weight of 293.94 g/mol. IUPAC name: 3,5-dibromo-2-methylbenzoic acid. InChIKey: ZEZXVIRBOFKOMW-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O2 |
|---|---|
| Molecular weight | 293.94 g/mol |
| IUPAC name | 3,5-dibromo-2-methylbenzoic acid |
| InChIKey | ZEZXVIRBOFKOMW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Br)Br)C(=O)O |
Computed by PubChem (NCBI)