Products 58707-03-2

CAS 58707-03-2 is the registry number for 2,4-Dibromo-6-methylbenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2,4-dibromo-6-methylbenzoic acid (CAS 58707-03-2) is a chemical compound with the molecular formula C8H6Br2O2 and a molecular weight of 293.94 g/mol. IUPAC name: 2,4-dibromo-6-methylbenzoic acid. InChIKey: HWRXYRHOEOTSLN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6Br2O2
Molecular weight293.94 g/mol
IUPAC name2,4-dibromo-6-methylbenzoic acid
InChIKeyHWRXYRHOEOTSLN-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1C(=O)O)Br)Br

Computed by PubChem (NCBI)