CAS 58707-03-2 is the registry number for 2,4-Dibromo-6-methylbenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
2,4-dibromo-6-methylbenzoic acid (CAS 58707-03-2) is a chemical compound with the molecular formula C8H6Br2O2 and a molecular weight of 293.94 g/mol. IUPAC name: 2,4-dibromo-6-methylbenzoic acid. InChIKey: HWRXYRHOEOTSLN-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O2 |
|---|---|
| Molecular weight | 293.94 g/mol |
| IUPAC name | 2,4-dibromo-6-methylbenzoic acid |
| InChIKey | HWRXYRHOEOTSLN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)O)Br)Br |
Computed by PubChem (NCBI)